C20H20F20I2Si2 — CID 88674831
(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-icosafluoro-1,14-diiodo-14-trimethylsilyltetradeca-1,13-dienyl)-trimethylsilane (PubChem CID 88674831) has the molecular formula C20H20F20I2Si2 and a molecular weight of 950.32 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-icosafluoro-1,14-diiodo-14-trimethylsilyltetradeca-1,13-dienyl)-trimethylsilane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-icosafluoro-1,14-diiodo-14-trimethylsilyltetradeca-1,13-dienyl)-trimethylsilane |
|---|---|
| PubChem CID | 88674831 |
| Molecular Formula | C20H20F20I2Si2 |
| Molecular Weight | 950.32 g/mol |
| Exact Mass | 949.89 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-icosafluoro-1,14-diiodo-14-trimethylsilyltetradeca-1,13-dienyl)-trimethylsilane |
| SMILES | C[Si](C)(C)C(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C(I)[Si](C)(C)C |
| InChI | InChI=1S/C20H20F20I2Si2/c1-43(2,3)9(41)7-11(21,22)13(25,26)15(29,30)17(33,34)19(37,38)20(39,40)18(35,36)16(31,32)14(27,28)12(23,24)8-10(42)44(4,5)6/h7-8H,1-6H3 |
| InChIKey | GFULEKACVTUWRY-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.32 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|