C19H20N8O5S3 — CID 88675300
(6R)-7-[[(2Z)-2-(4-aminopyrimidin-2-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88675300) has the molecular formula C19H20N8O5S3 and a molecular weight of 536.62 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(4-aminopyrimidin-2-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(4-aminopyrimidin-2-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88675300 |
| Molecular Formula | C19H20N8O5S3 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(4-aminopyrimidin-2-yl)-2-propoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3nncs3)CS[C@H]12)c1nccc(N)n1 |
| InChI | InChI=1S/C19H20N8O5S3/c1-2-5-32-26-11(14-21-4-3-10(20)23-14)15(28)24-12-16(29)27-13(18(30)31)9(6-33-17(12)27)7-34-19-25-22-8-35-19/h3-4,8,12,17H,2,5-7H2,1H3,(H,24,28)(H,30,31)(H2,20,21,23)/b26-11-/t12?,17-/m1/s1 |
| InChIKey | NDIKGUUSVYMBHN-WNBTZEOMSA-N |
| XLogP | 0.57 |
| TPSA | 185.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|