About propanoyl 2,3-dibromopropanoate
propanoyl 2,3-dibromopropanoate (PubChem CID 88675579) has the molecular formula C6H8Br2O3
and a molecular weight of 287.94 g/mol. Its IUPAC name is propanoyl 2,3-dibromopropanoate.
Molecular Properties
| Compound Name | propanoyl 2,3-dibromopropanoate |
| PubChem CID | 88675579 |
| Molecular Formula | C6H8Br2O3 |
| Molecular Weight | 287.94 g/mol |
| Exact Mass | 285.88 |
| IUPAC Name | propanoyl 2,3-dibromopropanoate |
| SMILES | CCC(=O)OC(=O)C(Br)CBr |
| InChI | InChI=1S/C6H8Br2O3/c1-2-5(9)11-6(10)4(8)3-7/h4H,2-3H2,1H3 |
| InChIKey | FMOVTYGWZBMYLS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.94 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanoyl 2,3-dibromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyl 2,3-dibromopropanoate?
The IUPAC name of propanoyl 2,3-dibromopropanoate (CID 88675579) is propanoyl 2,3-dibromopropanoate.
What is the SMILES notation for propanoyl 2,3-dibromopropanoate?
The canonical SMILES for propanoyl 2,3-dibromopropanoate is CCC(=O)OC(=O)C(Br)CBr.
What is the InChIKey of propanoyl 2,3-dibromopropanoate?
The InChIKey is FMOVTYGWZBMYLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Br2O3/c1-2-5(9)11-6(10)4(8)3-7/h4H,2-3H2,1H3.
What are the key properties of propanoyl 2,3-dibromopropanoate?
propanoyl 2,3-dibromopropanoate has a molecular weight of 287.94 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyl 2,3-dibromopropanoate is sourced from PubChem (CID 88675579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).