About carbamic acid;N-sulfanylidenecarbamoyl fluoride
carbamic acid;N-sulfanylidenecarbamoyl fluoride (PubChem CID 88675912) has the molecular formula C2H3FN2O3S
and a molecular weight of 154.12 g/mol. Its IUPAC name is carbamic acid;N-sulfanylidenecarbamoyl fluoride.
Molecular Properties
| Compound Name | carbamic acid;N-sulfanylidenecarbamoyl fluoride |
| PubChem CID | 88675912 |
| Molecular Formula | C2H3FN2O3S |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 153.98 |
| IUPAC Name | carbamic acid;N-sulfanylidenecarbamoyl fluoride |
| SMILES | NC(=O)O.O=C(F)N=S |
| InChI | InChI=1S/CFNOS.CH3NO2/c2-1(4)3-5;2-1(3)4/h;2H2,(H,3,4) |
| InChIKey | QPSCUSPCOVXELC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;N-sulfanylidenecarbamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;N-sulfanylidenecarbamoyl fluoride?
The IUPAC name of carbamic acid;N-sulfanylidenecarbamoyl fluoride (CID 88675912) is carbamic acid;N-sulfanylidenecarbamoyl fluoride.
What is the SMILES notation for carbamic acid;N-sulfanylidenecarbamoyl fluoride?
The canonical SMILES for carbamic acid;N-sulfanylidenecarbamoyl fluoride is NC(=O)O.O=C(F)N=S.
What is the InChIKey of carbamic acid;N-sulfanylidenecarbamoyl fluoride?
The InChIKey is QPSCUSPCOVXELC-UHFFFAOYSA-N. The full InChI is InChI=1S/CFNOS.CH3NO2/c2-1(4)3-5;2-1(3)4/h;2H2,(H,3,4).
What are the key properties of carbamic acid;N-sulfanylidenecarbamoyl fluoride?
carbamic acid;N-sulfanylidenecarbamoyl fluoride has a molecular weight of 154.12 g/mol, XLogP of 0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;N-sulfanylidenecarbamoyl fluoride is sourced from PubChem (CID 88675912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).