C22H32O3 — CID 88676481
(5Z)-5-[(1S,3R,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-7-bicyclo[4.2.0]octanylidene]pentanal (PubChem CID 88676481) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (5Z)-5-[(1S,3R,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-7-bicyclo[4.2.0]octanylidene]pentanal.
| Compound Name | (5Z)-5-[(1S,3R,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-7-bicyclo[4.2.0]octanylidene]pentanal |
|---|---|
| PubChem CID | 88676481 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (5Z)-5-[(1S,3R,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-7-bicyclo[4.2.0]octanylidene]pentanal |
| SMILES | O=CCCC/C=C1/C[C@@H]2C(C#CC(O)C3CCCCC3)[C@H](O)CC[C@H]12 |
| InChI | InChI=1S/C22H32O3/c23-14-6-2-5-9-17-15-20-18(17)10-13-22(25)19(20)11-12-21(24)16-7-3-1-4-8-16/h9,14,16,18-22,24-25H,1-8,10,13,15H2/b17-9-/t18-,19?,20+,21?,22-/m1/s1 |
| InChIKey | DWWMJFWGQRCEIA-GEBDEEEXSA-N |
| XLogP | 3.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|