About 6-ethoxy-N,9-dimethylpurin-2-amine
6-ethoxy-N,9-dimethylpurin-2-amine (PubChem CID 88677482) has the molecular formula C9H13N5O
and a molecular weight of 207.24 g/mol. Its IUPAC name is 6-ethoxy-N,9-dimethylpurin-2-amine.
Molecular Properties
| Compound Name | 6-ethoxy-N,9-dimethylpurin-2-amine |
| PubChem CID | 88677482 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 6-ethoxy-N,9-dimethylpurin-2-amine |
| SMILES | CCOc1nc(NC)nc2c1ncn2C |
| InChI | InChI=1S/C9H13N5O/c1-4-15-8-6-7(14(3)5-11-6)12-9(10-2)13-8/h5H,4H2,1-3H3,(H,10,12,13) |
| InChIKey | XMDYWLKMUGSFLA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-ethoxy-N,9-dimethylpurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-N,9-dimethylpurin-2-amine?
The IUPAC name of 6-ethoxy-N,9-dimethylpurin-2-amine (CID 88677482) is 6-ethoxy-N,9-dimethylpurin-2-amine.
What is the SMILES notation for 6-ethoxy-N,9-dimethylpurin-2-amine?
The canonical SMILES for 6-ethoxy-N,9-dimethylpurin-2-amine is CCOc1nc(NC)nc2c1ncn2C.
What is the InChIKey of 6-ethoxy-N,9-dimethylpurin-2-amine?
The InChIKey is XMDYWLKMUGSFLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O/c1-4-15-8-6-7(14(3)5-11-6)12-9(10-2)13-8/h5H,4H2,1-3H3,(H,10,12,13).
What are the key properties of 6-ethoxy-N,9-dimethylpurin-2-amine?
6-ethoxy-N,9-dimethylpurin-2-amine has a molecular weight of 207.24 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-N,9-dimethylpurin-2-amine is sourced from PubChem (CID 88677482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).