About ethanol;2-hydroxypropanal
ethanol;2-hydroxypropanal (PubChem CID 88677819) has the molecular formula C5H12O3
and a molecular weight of 120.15 g/mol. Its IUPAC name is ethanol;2-hydroxypropanal.
Molecular Properties
| Compound Name | ethanol;2-hydroxypropanal |
| PubChem CID | 88677819 |
| Molecular Formula | C5H12O3 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | ethanol;2-hydroxypropanal |
| SMILES | CC(O)C=O.CCO |
| InChI | InChI=1S/C3H6O2.C2H6O/c1-3(5)2-4;1-2-3/h2-3,5H,1H3;3H,2H2,1H3 |
| InChIKey | NXDCMJXIEUUGIE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-hydroxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-hydroxypropanal?
The IUPAC name of ethanol;2-hydroxypropanal (CID 88677819) is ethanol;2-hydroxypropanal.
What is the SMILES notation for ethanol;2-hydroxypropanal?
The canonical SMILES for ethanol;2-hydroxypropanal is CC(O)C=O.CCO.
What is the InChIKey of ethanol;2-hydroxypropanal?
The InChIKey is NXDCMJXIEUUGIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.C2H6O/c1-3(5)2-4;1-2-3/h2-3,5H,1H3;3H,2H2,1H3.
What are the key properties of ethanol;2-hydroxypropanal?
ethanol;2-hydroxypropanal has a molecular weight of 120.15 g/mol, XLogP of -0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-hydroxypropanal is sourced from PubChem (CID 88677819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).