C25H21Cl2N3O7 — CID 88677915
(Z)-2,3-dichloro-4-oxo-4-[[(3E)-9-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-6-yl]amino]but-2-enoic acid (PubChem CID 88677915) has the molecular formula C25H21Cl2N3O7 and a molecular weight of 546.36 g/mol. Its IUPAC name is (Z)-2,3-dichloro-4-oxo-4-[[(3E)-9-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-6-yl]amino]but-2-enoic acid.
| Compound Name | (Z)-2,3-dichloro-4-oxo-4-[[(3E)-9-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-6-yl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 88677915 |
| Molecular Formula | C25H21Cl2N3O7 |
| Molecular Weight | 546.36 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | (Z)-2,3-dichloro-4-oxo-4-[[(3E)-9-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-6-yl]amino]but-2-enoic acid |
| SMILES | COc1cc(/C=C2\CCn3c2nc2cc(NC(=O)/C(Cl)=C(/Cl)C(=O)O)ccc2c3=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H21Cl2N3O7/c1-35-17-9-12(10-18(36-2)21(17)37-3)8-13-6-7-30-22(13)29-16-11-14(4-5-15(16)24(30)32)28-23(31)19(26)20(27)25(33)34/h4-5,8-11H,6-7H2,1-3H3,(H,28,31)(H,33,34)/b13-8+,20-19- |
| InChIKey | LHCRDECCWKXUSK-XOXUYICPSA-N |
| XLogP | 4.08 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|