C17H17N5O2S — CID 88678167
1-[4-(5-methyl-3-oxo-4,5-dihydro-2H-1,2,4-triazin-6-yl)phenyl]-3-phenyl-1-sulfanylurea (PubChem CID 88678167) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 1-[4-(5-methyl-3-oxo-4,5-dihydro-2H-1,2,4-triazin-6-yl)phenyl]-3-phenyl-1-sulfanylurea.
| Compound Name | 1-[4-(5-methyl-3-oxo-4,5-dihydro-2H-1,2,4-triazin-6-yl)phenyl]-3-phenyl-1-sulfanylurea |
|---|---|
| PubChem CID | 88678167 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-[4-(5-methyl-3-oxo-4,5-dihydro-2H-1,2,4-triazin-6-yl)phenyl]-3-phenyl-1-sulfanylurea |
| SMILES | CC1NC(=O)NN=C1c1ccc(N(S)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17N5O2S/c1-11-15(20-21-16(23)18-11)12-7-9-14(10-8-12)22(25)17(24)19-13-5-3-2-4-6-13/h2-11,25H,1H3,(H,19,24)(H2,18,21,23) |
| InChIKey | KBVFSHDHXGYZKM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|