About sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol
sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol (PubChem CID 88679015) has the molecular formula C2H4Cl3NaO6P2+2
and a molecular weight of 315.35 g/mol. Its IUPAC name is sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol.
Molecular Properties
| Compound Name | sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol |
| PubChem CID | 88679015 |
| Molecular Formula | C2H4Cl3NaO6P2+2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 313.84 |
| IUPAC Name | sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol |
| SMILES | O=[P+]([O-])O[P+](=O)O.OCC(Cl)(Cl)Cl.[Na+] |
| InChI | InChI=1S/C2H3Cl3O.Na.O5P2/c3-2(4,5)1-6;;1-6(2)5-7(3)4/h6H,1H2;;/q;+1;/p+1 |
| InChIKey | LDLVBEJDIJPSKQ-UHFFFAOYSA-O |
| XLogP | -1.98 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol?
The IUPAC name of sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol (CID 88679015) is sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol.
What is the SMILES notation for sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol?
The canonical SMILES for sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol is O=[P+]([O-])O[P+](=O)O.OCC(Cl)(Cl)Cl.[Na+].
What is the InChIKey of sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol?
The InChIKey is LDLVBEJDIJPSKQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H3Cl3O.Na.O5P2/c3-2(4,5)1-6;;1-6(2)5-7(3)4/h6H,1H2;;/q;+1;/p+1.
What are the key properties of sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol?
sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol has a molecular weight of 315.35 g/mol, XLogP of -1.98, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydroxy-oxo-phosphooxyphosphanium;2,2,2-trichloroethanol is sourced from PubChem (CID 88679015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).