About S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate
S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate (PubChem CID 88679337) has the molecular formula C21H16N2O4S
and a molecular weight of 392.44 g/mol. Its IUPAC name is S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate.
Molecular Properties
| Compound Name | S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate |
| PubChem CID | 88679337 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate |
| SMILES | CSC(=O)/C(=C\c1ccccc1)N1CC(N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C21H16N2O4S/c1-28-21(27)16(11-13-7-3-2-4-8-13)22-12-17(20(22)26)23-18(24)14-9-5-6-10-15(14)19(23)25/h2-11,17H,12H2,1H3/b16-11+ |
| InChIKey | ZZPDMTRTZDWMDA-LFIBNONCSA-N |
| XLogP | 2.42 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate?
The IUPAC name of S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate (CID 88679337) is S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate.
What is the SMILES notation for S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate?
The canonical SMILES for S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate is CSC(=O)/C(=C\c1ccccc1)N1CC(N2C(=O)c3ccccc3C2=O)C1=O.
What is the InChIKey of S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate?
The InChIKey is ZZPDMTRTZDWMDA-LFIBNONCSA-N. The full InChI is InChI=1S/C21H16N2O4S/c1-28-21(27)16(11-13-7-3-2-4-8-13)22-12-17(20(22)26)23-18(24)14-9-5-6-10-15(14)19(23)25/h2-11,17H,12H2,1H3/b16-11+.
What are the key properties of S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate?
S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate has a molecular weight of 392.44 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-phenylprop-2-enethioate is sourced from PubChem (CID 88679337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).