About chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium
chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium (PubChem CID 88679481) has the molecular formula CH3ClHgO5P2+2
and a molecular weight of 393.02 g/mol. Its IUPAC name is chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium.
Molecular Properties
| Compound Name | chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium |
| PubChem CID | 88679481 |
| Molecular Formula | CH3ClHgO5P2+2 |
| Molecular Weight | 393.02 g/mol |
| Exact Mass | 393.88 |
| IUPAC Name | chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium |
| SMILES | CCl.O=[P+]([O-])O[P+](=O)[O-].[Hg+2] |
| InChI | InChI=1S/CH3Cl.Hg.O5P2/c1-2;;1-6(2)5-7(3)4/h1H3;;/q;+2; |
| InChIKey | PCNSZFAZRUHTRX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.02 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium?
The IUPAC name of chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium (CID 88679481) is chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium.
What is the SMILES notation for chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium?
The canonical SMILES for chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium is CCl.O=[P+]([O-])O[P+](=O)[O-].[Hg+2].
What is the InChIKey of chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium?
The InChIKey is PCNSZFAZRUHTRX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3Cl.Hg.O5P2/c1-2;;1-6(2)5-7(3)4/h1H3;;/q;+2;.
What are the key properties of chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium?
chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium has a molecular weight of 393.02 g/mol, XLogP of -0.11, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;mercury(2+);oxido-oxo-phosphooxyphosphanium is sourced from PubChem (CID 88679481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).