About barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium
barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium (PubChem CID 88679802) has the molecular formula CH2BaBr2O5P2+2
and a molecular weight of 453.11 g/mol. Its IUPAC name is barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium.
Molecular Properties
| Compound Name | barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium |
| PubChem CID | 88679802 |
| Molecular Formula | CH2BaBr2O5P2+2 |
| Molecular Weight | 453.11 g/mol |
| Exact Mass | 451.68 |
| IUPAC Name | barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium |
| SMILES | BrCBr.O=[P+]([O-])O[P+](=O)[O-].[Ba+2] |
| InChI | InChI=1S/CH2Br2.Ba.O5P2/c2-1-3;;1-6(2)5-7(3)4/h1H2;;/q;+2; |
| InChIKey | JEVPGFFSWHHCMR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.11 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium?
The IUPAC name of barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium (CID 88679802) is barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium.
What is the SMILES notation for barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium?
The canonical SMILES for barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium is BrCBr.O=[P+]([O-])O[P+](=O)[O-].[Ba+2].
What is the InChIKey of barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium?
The InChIKey is JEVPGFFSWHHCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2Br2.Ba.O5P2/c2-1-3;;1-6(2)5-7(3)4/h1H2;;/q;+2;.
What are the key properties of barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium?
barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium has a molecular weight of 453.11 g/mol, XLogP of 0.39, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);dibromomethane;oxido-oxo-phosphooxyphosphanium is sourced from PubChem (CID 88679802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).