C33H50N2O2 — CID 88679989
N'-(2,3,4,5-tetracyclohexylphenyl)propanediamide (PubChem CID 88679989) has the molecular formula C33H50N2O2 and a molecular weight of 506.78 g/mol. Its IUPAC name is N'-(2,3,4,5-tetracyclohexylphenyl)propanediamide.
| Compound Name | N'-(2,3,4,5-tetracyclohexylphenyl)propanediamide |
|---|---|
| PubChem CID | 88679989 |
| Molecular Formula | C33H50N2O2 |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.39 |
| IUPAC Name | N'-(2,3,4,5-tetracyclohexylphenyl)propanediamide |
| SMILES | NC(=O)CC(=O)Nc1cc(C2CCCCC2)c(C2CCCCC2)c(C2CCCCC2)c1C1CCCCC1 |
| InChI | InChI=1S/C33H50N2O2/c34-29(36)22-30(37)35-28-21-27(23-13-5-1-6-14-23)31(24-15-7-2-8-16-24)33(26-19-11-4-12-20-26)32(28)25-17-9-3-10-18-25/h21,23-26H,1-20,22H2,(H2,34,36)(H,35,37) |
| InChIKey | IPNVLRVEWYNLHX-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|