About 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione
1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 886800) has the molecular formula C12H12N2O3S
and a molecular weight of 264.31 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
Molecular Properties
| Compound Name | 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| PubChem CID | 886800 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCOc1cccc(N2C(=O)CC(=O)NC2=S)c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-2-17-9-5-3-4-8(6-9)14-11(16)7-10(15)13-12(14)18/h3-6H,2,7H2,1H3,(H,13,15,18) |
| InChIKey | VUNZLOZKCNSACK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione?
The IUPAC name of 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (CID 886800) is 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
What is the SMILES notation for 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione?
The canonical SMILES for 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione is CCOc1cccc(N2C(=O)CC(=O)NC2=S)c1.
What is the InChIKey of 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione?
The InChIKey is VUNZLOZKCNSACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3S/c1-2-17-9-5-3-4-8(6-9)14-11(16)7-10(15)13-12(14)18/h3-6H,2,7H2,1H3,(H,13,15,18).
What are the key properties of 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione?
1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione has a molecular weight of 264.31 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione is sourced from PubChem (CID 886800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).