C20H17Cl6N3O2 — CID 88680140
2-(2-pyrazin-2-ylethylamino)ethanol;1,3,5-trichloro-2-(2,4,6-trichlorophenoxy)benzene (PubChem CID 88680140) has the molecular formula C20H17Cl6N3O2 and a molecular weight of 544.09 g/mol. Its IUPAC name is 2-(2-pyrazin-2-ylethylamino)ethanol;1,3,5-trichloro-2-(2,4,6-trichlorophenoxy)benzene.
| Compound Name | 2-(2-pyrazin-2-ylethylamino)ethanol;1,3,5-trichloro-2-(2,4,6-trichlorophenoxy)benzene |
|---|---|
| PubChem CID | 88680140 |
| Molecular Formula | C20H17Cl6N3O2 |
| Molecular Weight | 544.09 g/mol |
| Exact Mass | 540.95 |
| IUPAC Name | 2-(2-pyrazin-2-ylethylamino)ethanol;1,3,5-trichloro-2-(2,4,6-trichlorophenoxy)benzene |
| SMILES | Clc1cc(Cl)c(Oc2c(Cl)cc(Cl)cc2Cl)c(Cl)c1.OCCNCCc1cnccn1 |
| InChI | InChI=1S/C12H4Cl6O.C8H13N3O/c13-5-1-7(15)11(8(16)2-5)19-12-9(17)3-6(14)4-10(12)18;12-6-5-9-2-1-8-7-10-3-4-11-8/h1-4H;3-4,7,9,12H,1-2,5-6H2 |
| InChIKey | WWQKKONAHXDCBB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.09 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|