C6H4ClF3N2OS — CID 88680347
N-[5-(chloromethyl)-1,3-thiazol-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 88680347) has the molecular formula C6H4ClF3N2OS and a molecular weight of 244.63 g/mol. Its IUPAC name is N-[5-(chloromethyl)-1,3-thiazol-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[5-(chloromethyl)-1,3-thiazol-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88680347 |
| Molecular Formula | C6H4ClF3N2OS |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | N-[5-(chloromethyl)-1,3-thiazol-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ncc(CCl)s1)C(F)(F)F |
| InChI | InChI=1S/C6H4ClF3N2OS/c7-1-3-2-11-5(14-3)12-4(13)6(8,9)10/h2H,1H2,(H,11,12,13) |
| InChIKey | FBBYJEGKJYBSHT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|