C8H11F3N4OS — CID 88680398
N-[5-[(2-aminoethylamino)methyl]-1,3-thiazol-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 88680398) has the molecular formula C8H11F3N4OS and a molecular weight of 268.26 g/mol. Its IUPAC name is N-[5-[(2-aminoethylamino)methyl]-1,3-thiazol-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[5-[(2-aminoethylamino)methyl]-1,3-thiazol-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88680398 |
| Molecular Formula | C8H11F3N4OS |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N-[5-[(2-aminoethylamino)methyl]-1,3-thiazol-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | NCCNCc1cnc(NC(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C8H11F3N4OS/c9-8(10,11)6(16)15-7-14-4-5(17-7)3-13-2-1-12/h4,13H,1-3,12H2,(H,14,15,16) |
| InChIKey | TUBVUBFLEPGMMH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|