C12F21N — CID 88680708
2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-hexadecafluoro-1-(1,1,2,3,3-pentafluoroprop-2-enyl)quinoline (PubChem CID 88680708) has the molecular formula C12F21N and a molecular weight of 557.10 g/mol. Its IUPAC name is 2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-hexadecafluoro-1-(1,1,2,3,3-pentafluoroprop-2-enyl)quinoline.
| Compound Name | 2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-hexadecafluoro-1-(1,1,2,3,3-pentafluoroprop-2-enyl)quinoline |
|---|---|
| PubChem CID | 88680708 |
| Molecular Formula | C12F21N |
| Molecular Weight | 557.10 g/mol |
| Exact Mass | 556.97 |
| IUPAC Name | 2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8,8a-hexadecafluoro-1-(1,1,2,3,3-pentafluoroprop-2-enyl)quinoline |
| SMILES | FC(F)=C(F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C12F |
| InChI | InChI=1S/C12F21N/c13-1(2(14)15)3(16,17)34-11(31)4(18,6(21,22)10(29,30)12(34,32)33)5(19,20)7(23,24)8(25,26)9(11,27)28 |
| InChIKey | JZWOHIJKFDDEJI-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.10 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|