C15H8Cl2F6O3S — CID 88681056
[2,6-dichloro-4-(trifluoromethyl)phenyl] 2-(2,2,2-trifluoroethyl)benzenesulfonate (PubChem CID 88681056) has the molecular formula C15H8Cl2F6O3S and a molecular weight of 453.19 g/mol. Its IUPAC name is [2,6-dichloro-4-(trifluoromethyl)phenyl] 2-(2,2,2-trifluoroethyl)benzenesulfonate.
| Compound Name | [2,6-dichloro-4-(trifluoromethyl)phenyl] 2-(2,2,2-trifluoroethyl)benzenesulfonate |
|---|---|
| PubChem CID | 88681056 |
| Molecular Formula | C15H8Cl2F6O3S |
| Molecular Weight | 453.19 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | [2,6-dichloro-4-(trifluoromethyl)phenyl] 2-(2,2,2-trifluoroethyl)benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(Cl)cc(C(F)(F)F)cc1Cl)c1ccccc1CC(F)(F)F |
| InChI | InChI=1S/C15H8Cl2F6O3S/c16-10-5-9(15(21,22)23)6-11(17)13(10)26-27(24,25)12-4-2-1-3-8(12)7-14(18,19)20/h1-6H,7H2 |
| InChIKey | LYSNBBVADLWJKP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.19 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|