C20H22N2O6Pt — CID 88681091
cyclobutane-1,1-dicarboxylate;4-[1,2-diamino-2-(4-hydroxyphenyl)ethyl]phenol;platinum(2+) (PubChem CID 88681091) has the molecular formula C20H22N2O6Pt and a molecular weight of 581.48 g/mol. Its IUPAC name is cyclobutane-1,1-dicarboxylate;4-[1,2-diamino-2-(4-hydroxyphenyl)ethyl]phenol;platinum(2+).
| Compound Name | cyclobutane-1,1-dicarboxylate;4-[1,2-diamino-2-(4-hydroxyphenyl)ethyl]phenol;platinum(2+) |
|---|---|
| PubChem CID | 88681091 |
| Molecular Formula | C20H22N2O6Pt |
| Molecular Weight | 581.48 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | cyclobutane-1,1-dicarboxylate;4-[1,2-diamino-2-(4-hydroxyphenyl)ethyl]phenol;platinum(2+) |
| SMILES | NC(c1ccc(O)cc1)C(N)c1ccc(O)cc1.O=C([O-])C1(C(=O)[O-])CCC1.[Pt+2] |
| InChI | InChI=1S/C14H16N2O2.C6H8O4.Pt/c15-13(9-1-5-11(17)6-2-9)14(16)10-3-7-12(18)8-4-10;7-4(8)6(5(9)10)2-1-3-6;/h1-8,13-14,17-18H,15-16H2;1-3H2,(H,7,8)(H,9,10);/q;;+2/p-2 |
| InChIKey | YDZQPJNQVOCBOQ-UHFFFAOYSA-L |
| XLogP | -0.55 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.48 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|