About 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol
4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol (PubChem CID 88681264) has the molecular formula C30H62N2O3
and a molecular weight of 498.84 g/mol. Its IUPAC name is 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol.
Molecular Properties
| Compound Name | 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol |
| PubChem CID | 88681264 |
| Molecular Formula | C30H62N2O3 |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 498.48 |
| IUPAC Name | 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNCC(CC(C)O)C(N)(CC(C)O)CC(C)O |
| InChI | InChI=1S/C30H62N2O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-32-25-29(22-26(2)33)30(31,23-27(3)34)24-28(4)35/h12-13,26-29,32-35H,5-11,14-25,31H2,1-4H3/b13-12- |
| InChIKey | DWEAOJIAVNXSNX-SEYXRHQNSA-N |
| XLogP | 6.24 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol?
The IUPAC name of 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol (CID 88681264) is 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol.
What is the SMILES notation for 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol?
The canonical SMILES for 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol is CCCCCCCC/C=C\CCCCCCCCNCC(CC(C)O)C(N)(CC(C)O)CC(C)O.
What is the InChIKey of 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol?
The InChIKey is DWEAOJIAVNXSNX-SEYXRHQNSA-N. The full InChI is InChI=1S/C30H62N2O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-32-25-29(22-26(2)33)30(31,23-27(3)34)24-28(4)35/h12-13,26-29,32-35H,5-11,14-25,31H2,1-4H3/b13-12-.
What are the key properties of 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol?
4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol has a molecular weight of 498.84 g/mol, XLogP of 6.24, 25 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-(2-hydroxypropyl)-5-[[[(Z)-octadec-9-enyl]amino]methyl]octane-2,7-diol is sourced from PubChem (CID 88681264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).