About 5-fluoropentylurea
5-fluoropentylurea (PubChem CID 88681885) has the molecular formula C6H13FN2O
and a molecular weight of 148.18 g/mol. Its IUPAC name is 5-fluoropentylurea.
Molecular Properties
| Compound Name | 5-fluoropentylurea |
| PubChem CID | 88681885 |
| Molecular Formula | C6H13FN2O |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 5-fluoropentylurea |
| SMILES | NC(=O)NCCCCCF |
| InChI | InChI=1S/C6H13FN2O/c7-4-2-1-3-5-9-6(8)10/h1-5H2,(H3,8,9,10) |
| InChIKey | MVBMJZJDDLMQCZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoropentylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoropentylurea?
The IUPAC name of 5-fluoropentylurea (CID 88681885) is 5-fluoropentylurea.
What is the SMILES notation for 5-fluoropentylurea?
The canonical SMILES for 5-fluoropentylurea is NC(=O)NCCCCCF.
What is the InChIKey of 5-fluoropentylurea?
The InChIKey is MVBMJZJDDLMQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13FN2O/c7-4-2-1-3-5-9-6(8)10/h1-5H2,(H3,8,9,10).
What are the key properties of 5-fluoropentylurea?
5-fluoropentylurea has a molecular weight of 148.18 g/mol, XLogP of 0.79, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoropentylurea is sourced from PubChem (CID 88681885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).