(E)-2-acetylhex-4-enoic acid

C8H12O3 — CID 88682215

IUPAC(E)-2-acetylhex-4-enoic acid
SMILESC/C=C/CC(C(C)=O)C(=O)O
InChIInChI=1S/C8H12O3/c1-3-4-5-7(6(2)9)8(10)11/h3-4,7H,5H2,1-2H3,(H,10,11)/b4-3+
InChIKeyKDPCAEUGVXVTSN-ONEGZZNKSA-N
MW156.18 g/mol
LogP1.24
Rot. Bonds4

About (E)-2-acetylhex-4-enoic acid

(E)-2-acetylhex-4-enoic acid (PubChem CID 88682215) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (E)-2-acetylhex-4-enoic acid.

Molecular Properties

Compound Name(E)-2-acetylhex-4-enoic acid
PubChem CID88682215
Molecular FormulaC8H12O3
Molecular Weight156.18 g/mol
Exact Mass156.08
IUPAC Name(E)-2-acetylhex-4-enoic acid
SMILESC/C=C/CC(C(C)=O)C(=O)O
InChIInChI=1S/C8H12O3/c1-3-4-5-7(6(2)9)8(10)11/h3-4,7H,5H2,1-2H3,(H,10,11)/b4-3+
InChIKeyKDPCAEUGVXVTSN-ONEGZZNKSA-N
XLogP1.24
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.18
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-2-acetylhex-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2-acetylhex-4-enoic acid?
The IUPAC name of (E)-2-acetylhex-4-enoic acid (CID 88682215) is (E)-2-acetylhex-4-enoic acid.
What is the SMILES notation for (E)-2-acetylhex-4-enoic acid?
The canonical SMILES for (E)-2-acetylhex-4-enoic acid is C/C=C/CC(C(C)=O)C(=O)O.
What is the InChIKey of (E)-2-acetylhex-4-enoic acid?
The InChIKey is KDPCAEUGVXVTSN-ONEGZZNKSA-N. The full InChI is InChI=1S/C8H12O3/c1-3-4-5-7(6(2)9)8(10)11/h3-4,7H,5H2,1-2H3,(H,10,11)/b4-3+.
What are the key properties of (E)-2-acetylhex-4-enoic acid?
(E)-2-acetylhex-4-enoic acid has a molecular weight of 156.18 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-acetylhex-4-enoic acid is sourced from PubChem (CID 88682215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).