C16H19N2O3S+ — CID 8868231
[2-(methoxycarbonylamino)-2-oxoethyl]-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 8868231) has the molecular formula C16H19N2O3S+ and a molecular weight of 319.41 g/mol. Its IUPAC name is [2-(methoxycarbonylamino)-2-oxoethyl]-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | [2-(methoxycarbonylamino)-2-oxoethyl]-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 8868231 |
| Molecular Formula | C16H19N2O3S+ |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [2-(methoxycarbonylamino)-2-oxoethyl]-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | COC(=O)NC(=O)C[NH2+][C@H](c1ccc(C)cc1)c1cccs1 |
| InChI | InChI=1S/C16H18N2O3S/c1-11-5-7-12(8-6-11)15(13-4-3-9-22-13)17-10-14(19)18-16(20)21-2/h3-9,15,17H,10H2,1-2H3,(H,18,19,20)/p+1/t15-/m1/s1 |
| InChIKey | SONVIQLHKZDRPH-OAHLLOKOSA-O |
| XLogP | 1.59 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |