C10H3Cl2F7O2S — CID 88683271
1-(4,5-dichlorothiophen-2-yl)-4,4,5,5,6,6,6-heptafluorohexane-1,3-dione (PubChem CID 88683271) has the molecular formula C10H3Cl2F7O2S and a molecular weight of 391.09 g/mol. Its IUPAC name is 1-(4,5-dichlorothiophen-2-yl)-4,4,5,5,6,6,6-heptafluorohexane-1,3-dione.
| Compound Name | 1-(4,5-dichlorothiophen-2-yl)-4,4,5,5,6,6,6-heptafluorohexane-1,3-dione |
|---|---|
| PubChem CID | 88683271 |
| Molecular Formula | C10H3Cl2F7O2S |
| Molecular Weight | 391.09 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 1-(4,5-dichlorothiophen-2-yl)-4,4,5,5,6,6,6-heptafluorohexane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C10H3Cl2F7O2S/c11-3-1-5(22-7(3)12)4(20)2-6(21)8(13,14)9(15,16)10(17,18)19/h1H,2H2 |
| InChIKey | CZGNKKKOACVEEN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.09 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|