About hexa-2,4-diene-1,5-diamine
hexa-2,4-diene-1,5-diamine (PubChem CID 88683556) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is hexa-2,4-diene-1,5-diamine.
Molecular Properties
| Compound Name | hexa-2,4-diene-1,5-diamine |
| PubChem CID | 88683556 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | hexa-2,4-diene-1,5-diamine |
| SMILES | CC(N)=CC=CCN |
| InChI | InChI=1S/C6H12N2/c1-6(8)4-2-3-5-7/h2-4H,5,7-8H2,1H3 |
| InChIKey | VMHARBLOCSNMJB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hexa-2,4-diene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-2,4-diene-1,5-diamine?
The IUPAC name of hexa-2,4-diene-1,5-diamine (CID 88683556) is hexa-2,4-diene-1,5-diamine.
What is the SMILES notation for hexa-2,4-diene-1,5-diamine?
The canonical SMILES for hexa-2,4-diene-1,5-diamine is CC(N)=CC=CCN.
What is the InChIKey of hexa-2,4-diene-1,5-diamine?
The InChIKey is VMHARBLOCSNMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-6(8)4-2-3-5-7/h2-4H,5,7-8H2,1H3.
What are the key properties of hexa-2,4-diene-1,5-diamine?
hexa-2,4-diene-1,5-diamine has a molecular weight of 112.18 g/mol, XLogP of 0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-2,4-diene-1,5-diamine is sourced from PubChem (CID 88683556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).