About 1,3-benzotellurazol-3-ium tetrafluoroborate
1,3-benzotellurazol-3-ium tetrafluoroborate (PubChem CID 88683711) has the molecular formula C7H6BF4NTe
and a molecular weight of 318.54 g/mol. Its IUPAC name is 1,3-benzotellurazol-3-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 1,3-benzotellurazol-3-ium tetrafluoroborate |
| PubChem CID | 88683711 |
| Molecular Formula | C7H6BF4NTe |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 1,3-benzotellurazol-3-ium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc2[te]c[nH+]c2c1 |
| InChI | InChI=1S/C7H5NTe.BF4/c1-2-4-7-6(3-1)8-5-9-7;2-1(3,4)5/h1-5H;/q;-1/p+1 |
| InChIKey | MMGWCCOMHCQXBE-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,3-benzotellurazol-3-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzotellurazol-3-ium tetrafluoroborate?
The IUPAC name of 1,3-benzotellurazol-3-ium tetrafluoroborate (CID 88683711) is 1,3-benzotellurazol-3-ium tetrafluoroborate.
What is the SMILES notation for 1,3-benzotellurazol-3-ium tetrafluoroborate?
The canonical SMILES for 1,3-benzotellurazol-3-ium tetrafluoroborate is F[B-](F)(F)F.c1ccc2[te]c[nH+]c2c1.
What is the InChIKey of 1,3-benzotellurazol-3-ium tetrafluoroborate?
The InChIKey is MMGWCCOMHCQXBE-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H5NTe.BF4/c1-2-4-7-6(3-1)8-5-9-7;2-1(3,4)5/h1-5H;/q;-1/p+1.
What are the key properties of 1,3-benzotellurazol-3-ium tetrafluoroborate?
1,3-benzotellurazol-3-ium tetrafluoroborate has a molecular weight of 318.54 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzotellurazol-3-ium tetrafluoroborate is sourced from PubChem (CID 88683711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).