About (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate
(2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate (PubChem CID 88684050) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate.
Molecular Properties
| Compound Name | (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate |
| PubChem CID | 88684050 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate |
| SMILES | CCC1=C(C)CCC(C)(C)C1COC=O |
| InChI | InChI=1S/C13H22O2/c1-5-11-10(2)6-7-13(3,4)12(11)8-15-9-14/h9,12H,5-8H2,1-4H3 |
| InChIKey | DCJXYXKJTHXCJC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate?
The IUPAC name of (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate (CID 88684050) is (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate.
What is the SMILES notation for (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate?
The canonical SMILES for (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate is CCC1=C(C)CCC(C)(C)C1COC=O.
What is the InChIKey of (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate?
The InChIKey is DCJXYXKJTHXCJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-5-11-10(2)6-7-13(3,4)12(11)8-15-9-14/h9,12H,5-8H2,1-4H3.
What are the key properties of (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate?
(2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate has a molecular weight of 210.32 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-3,6,6-trimethylcyclohex-2-en-1-yl)methyl formate is sourced from PubChem (CID 88684050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).