C15H17N3O6 — CID 88684527
5-methyl-5,6,6-trinitrocyclohexa-1,3-diene;1,2-xylene (PubChem CID 88684527) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is 5-methyl-5,6,6-trinitrocyclohexa-1,3-diene;1,2-xylene.
| Compound Name | 5-methyl-5,6,6-trinitrocyclohexa-1,3-diene;1,2-xylene |
|---|---|
| PubChem CID | 88684527 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-methyl-5,6,6-trinitrocyclohexa-1,3-diene;1,2-xylene |
| SMILES | CC1([N+](=O)[O-])C=CC=CC1([N+](=O)[O-])[N+](=O)[O-].Cc1ccccc1C |
| InChI | InChI=1S/C8H10.C7H7N3O6/c1-7-5-3-4-6-8(7)2;1-6(8(11)12)4-2-3-5-7(6,9(13)14)10(15)16/h3-6H,1-2H3;2-5H,1H3 |
| InChIKey | NJHPDRXLVCAILV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|