C13H19FO3S — CID 88684654
trans-(1R,3R)-3-[(E)-3-tert-butylsulfanyl-2-fluoro-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 88684654) has the molecular formula C13H19FO3S and a molecular weight of 274.36 g/mol. Its IUPAC name is trans-(1R,3R)-3-[(E)-3-tert-butylsulfanyl-2-fluoro-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3R)-3-[(E)-3-tert-butylsulfanyl-2-fluoro-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 88684654 |
| Molecular Formula | C13H19FO3S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | trans-(1R,3R)-3-[(E)-3-tert-butylsulfanyl-2-fluoro-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC(C)(C)SC(=O)/C(F)=C\[C@H]1[C@@H](C(=O)O)C1(C)C |
| InChI | InChI=1S/C13H19FO3S/c1-12(2,3)18-11(17)8(14)6-7-9(10(15)16)13(7,4)5/h6-7,9H,1-5H3,(H,15,16)/b8-6+/t7-,9-/m0/s1 |
| InChIKey | WZCKUAUNPMJCGQ-RPAOPIHUSA-N |
| XLogP | 3.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|