About (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine
(E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine (PubChem CID 88684801) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine.
Molecular Properties
| Compound Name | (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine |
| PubChem CID | 88684801 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine |
| SMILES | C/C=C(\C)CN.CC/C=C(/C)N |
| InChI | InChI=1S/2C5H11N/c1-3-5(2)4-6;1-3-4-5(2)6/h3H,4,6H2,1-2H3;4H,3,6H2,1-2H3/b5-3+;5-4- |
| InChIKey | WRLQBJRSTICTRS-CXUDCQRXSA-N |
| XLogP | 2.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine?
The IUPAC name of (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine (CID 88684801) is (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine.
What is the SMILES notation for (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine?
The canonical SMILES for (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine is C/C=C(\C)CN.CC/C=C(/C)N.
What is the InChIKey of (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine?
The InChIKey is WRLQBJRSTICTRS-CXUDCQRXSA-N. The full InChI is InChI=1S/2C5H11N/c1-3-5(2)4-6;1-3-4-5(2)6/h3H,4,6H2,1-2H3;4H,3,6H2,1-2H3/b5-3+;5-4-.
What are the key properties of (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine?
(E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine has a molecular weight of 170.30 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methylbut-2-en-1-amine;(Z)-pent-2-en-2-amine is sourced from PubChem (CID 88684801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).