About (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid
(1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid (PubChem CID 88684882) has the molecular formula C8H14Br2O4
and a molecular weight of 334.00 g/mol. Its IUPAC name is (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid.
Molecular Properties
| Compound Name | (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid |
| PubChem CID | 88684882 |
| Molecular Formula | C8H14Br2O4 |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 331.93 |
| IUPAC Name | (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(C)(CO)C(Br)OBr |
| InChI | InChI=1S/C5H10Br2O2.C3H4O2/c1-5(2,3-8)4(6)9-7;1-2-3(4)5/h4,8H,3H2,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | DTHTZPUDBUUACP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid?
The IUPAC name of (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid (CID 88684882) is (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid.
What is the SMILES notation for (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid?
The canonical SMILES for (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid is C=CC(=O)O.CC(C)(CO)C(Br)OBr.
What is the InChIKey of (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid?
The InChIKey is DTHTZPUDBUUACP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10Br2O2.C3H4O2/c1-5(2,3-8)4(6)9-7;1-2-3(4)5/h4,8H,3H2,1-2H3;2H,1H2,(H,4,5).
What are the key properties of (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid?
(1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid has a molecular weight of 334.00 g/mol, XLogP of 2.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-bromo-3-hydroxy-2,2-dimethylpropyl) hypobromite;prop-2-enoic acid is sourced from PubChem (CID 88684882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).