(2Z)-2-(fluoromethylidene)hexanoic acid

C7H11FO2 — CID 88684979

IUPAC(2Z)-2-(fluoromethylidene)hexanoic acid
SMILESCCCC/C(=C/F)C(=O)O
InChIInChI=1S/C7H11FO2/c1-2-3-4-6(5-8)7(9)10/h5H,2-4H2,1H3,(H,9,10)/b6-5-
InChIKeyLAEIMOLHKAJUTG-WAYWQWQTSA-N
MW146.16 g/mol
LogP2.11
Rot. Bonds4

About (2Z)-2-(fluoromethylidene)hexanoic acid

(2Z)-2-(fluoromethylidene)hexanoic acid (PubChem CID 88684979) has the molecular formula C7H11FO2 and a molecular weight of 146.16 g/mol. Its IUPAC name is (2Z)-2-(fluoromethylidene)hexanoic acid.

Molecular Properties

Compound Name(2Z)-2-(fluoromethylidene)hexanoic acid
PubChem CID88684979
Molecular FormulaC7H11FO2
Molecular Weight146.16 g/mol
Exact Mass146.07
IUPAC Name(2Z)-2-(fluoromethylidene)hexanoic acid
SMILESCCCC/C(=C/F)C(=O)O
InChIInChI=1S/C7H11FO2/c1-2-3-4-6(5-8)7(9)10/h5H,2-4H2,1H3,(H,9,10)/b6-5-
InChIKeyLAEIMOLHKAJUTG-WAYWQWQTSA-N
XLogP2.11
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.16
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2Z)-2-(fluoromethylidene)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z)-2-(fluoromethylidene)hexanoic acid?
The IUPAC name of (2Z)-2-(fluoromethylidene)hexanoic acid (CID 88684979) is (2Z)-2-(fluoromethylidene)hexanoic acid.
What is the SMILES notation for (2Z)-2-(fluoromethylidene)hexanoic acid?
The canonical SMILES for (2Z)-2-(fluoromethylidene)hexanoic acid is CCCC/C(=C/F)C(=O)O.
What is the InChIKey of (2Z)-2-(fluoromethylidene)hexanoic acid?
The InChIKey is LAEIMOLHKAJUTG-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H11FO2/c1-2-3-4-6(5-8)7(9)10/h5H,2-4H2,1H3,(H,9,10)/b6-5-.
What are the key properties of (2Z)-2-(fluoromethylidene)hexanoic acid?
(2Z)-2-(fluoromethylidene)hexanoic acid has a molecular weight of 146.16 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(fluoromethylidene)hexanoic acid is sourced from PubChem (CID 88684979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).