C21H23ClN4O5 — CID 88685089
(2S)-2-[[(2S)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 88685089) has the molecular formula C21H23ClN4O5 and a molecular weight of 446.89 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 88685089 |
| Molecular Formula | C21H23ClN4O5 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=NN(CCCl)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H23ClN4O5/c22-11-12-26(25-31)21(30)24-17(13-15-7-3-1-4-8-15)19(27)23-18(20(28)29)14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H,23,27)(H,24,30)(H,28,29)/t17-,18-/m0/s1 |
| InChIKey | XIBIFDXYQMZQGX-ROUUACIJSA-N |
| XLogP | 2.34 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|