C6H7Cl2F7Si — CID 88685115
dichloro-(1,1,2,2,5,5,5-heptafluoropentyl)-methylsilane (PubChem CID 88685115) has the molecular formula C6H7Cl2F7Si and a molecular weight of 311.10 g/mol. Its IUPAC name is dichloro-(1,1,2,2,5,5,5-heptafluoropentyl)-methylsilane.
| Compound Name | dichloro-(1,1,2,2,5,5,5-heptafluoropentyl)-methylsilane |
|---|---|
| PubChem CID | 88685115 |
| Molecular Formula | C6H7Cl2F7Si |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | dichloro-(1,1,2,2,5,5,5-heptafluoropentyl)-methylsilane |
| SMILES | C[Si](Cl)(Cl)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C6H7Cl2F7Si/c1-16(7,8)6(14,15)4(9,10)2-3-5(11,12)13/h2-3H2,1H3 |
| InChIKey | WWAUWWYCNBROND-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|