About (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol
(4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol (PubChem CID 88685421) has the molecular formula C17H18O7S
and a molecular weight of 366.39 g/mol. Its IUPAC name is (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol.
Molecular Properties
| Compound Name | (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol |
| PubChem CID | 88685421 |
| Molecular Formula | C17H18O7S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol |
| SMILES | COc1c2occc2c(OC)c2c(=O)cc(COC(C)=O)oc12.CS |
| InChI | InChI=1S/C16H14O7.CH4S/c1-8(17)22-7-9-6-11(18)12-13(19-2)10-4-5-21-14(10)16(20-3)15(12)23-9;1-2/h4-6H,7H2,1-3H3;2H,1H3 |
| InChIKey | LZTBJTGFSOMDBA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol?
The IUPAC name of (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol (CID 88685421) is (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol.
What is the SMILES notation for (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol?
The canonical SMILES for (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol is COc1c2occc2c(OC)c2c(=O)cc(COC(C)=O)oc12.CS.
What is the InChIKey of (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol?
The InChIKey is LZTBJTGFSOMDBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O7.CH4S/c1-8(17)22-7-9-6-11(18)12-13(19-2)10-4-5-21-14(10)16(20-3)15(12)23-9;1-2/h4-6H,7H2,1-3H3;2H,1H3.
What are the key properties of (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol?
(4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol has a molecular weight of 366.39 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4,9-dimethoxy-5-oxofuro[3,2-g]chromen-7-yl)methyl acetate;methanethiol is sourced from PubChem (CID 88685421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).