C24H28N2O7S3Te — CID 88685996
3-[5-methoxy-2-[2-[(12-methyl-4,6-dioxa-10-thia-2-tellura-12-azoniatricyclo[7.3.0.03,7]dodeca-1(9),7,11-trien-11-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide (PubChem CID 88685996) has the molecular formula C24H28N2O7S3Te and a molecular weight of 680.30 g/mol. Its IUPAC name is 3-[5-methoxy-2-[2-[(12-methyl-4,6-dioxa-10-thia-2-tellura-12-azoniatricyclo[7.3.0.03,7]dodeca-1(9),7,11-trien-11-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide.
| Compound Name | 3-[5-methoxy-2-[2-[(12-methyl-4,6-dioxa-10-thia-2-tellura-12-azoniatricyclo[7.3.0.03,7]dodeca-1(9),7,11-trien-11-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide |
|---|---|
| PubChem CID | 88685996 |
| Molecular Formula | C24H28N2O7S3Te |
| Molecular Weight | 680.30 g/mol |
| Exact Mass | 682.01 |
| IUPAC Name | 3-[5-methoxy-2-[2-[(12-methyl-4,6-dioxa-10-thia-2-tellura-12-azoniatricyclo[7.3.0.03,7]dodeca-1(9),7,11-trien-11-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide |
| SMILES | CCC(=Cc1sc2c([n+]1C)[Te]C1OCOC1=C2)C=C1Sc2ccc(OC)cc2N1CCCS(=O)(=O)O.[OH-] |
| InChI | InChI=1S/C24H26N2O6S3Te.H2O/c1-4-15(10-21-25(2)23-20(34-21)13-18-24(36-23)32-14-31-18)11-22-26(8-5-9-35(27,28)29)17-12-16(30-3)6-7-19(17)33-22;/h6-7,10-13,24H,4-5,8-9,14H2,1-3H3;1H2 |
| InChIKey | QDSZTEHSBZTJBO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|