C24H37NO7S2 — CID 88686054
(1R,4aS,10aR)-4a-methyl-7-propan-2-yl-1-(sulfomethyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid;(2S)-2-amino-4-sulfanylbutanoic acid (PubChem CID 88686054) has the molecular formula C24H37NO7S2 and a molecular weight of 515.69 g/mol. Its IUPAC name is (1R,4aS,10aR)-4a-methyl-7-propan-2-yl-1-(sulfomethyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid;(2S)-2-amino-4-sulfanylbutanoic acid.
| Compound Name | (1R,4aS,10aR)-4a-methyl-7-propan-2-yl-1-(sulfomethyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid;(2S)-2-amino-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 88686054 |
| Molecular Formula | C24H37NO7S2 |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | (1R,4aS,10aR)-4a-methyl-7-propan-2-yl-1-(sulfomethyl)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid;(2S)-2-amino-4-sulfanylbutanoic acid |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@@](CS(=O)(=O)O)(C(=O)O)CCC[C@]21C.N[C@@H](CCS)C(=O)O |
| InChI | InChI=1S/C20H28O5S.C4H9NO2S/c1-13(2)14-5-7-16-15(11-14)6-8-17-19(16,3)9-4-10-20(17,18(21)22)12-26(23,24)25;5-3(1-2-8)4(6)7/h5,7,11,13,17H,4,6,8-10,12H2,1-3H3,(H,21,22)(H,23,24,25);3,8H,1-2,5H2,(H,6,7)/t17-,19-,20-;3-/m10/s1 |
| InChIKey | PEUFHVYYOZOQLJ-CEQNXPNISA-N |
| XLogP | 3.49 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|