C21H29ClO3 — CID 88686070
(5S,8R,9S,10S,13S,14S)-2-chloro-10,13-dimethylspiro[5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,3'-dioxolane]-17-one (PubChem CID 88686070) has the molecular formula C21H29ClO3 and a molecular weight of 364.91 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S)-2-chloro-10,13-dimethylspiro[5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,3'-dioxolane]-17-one.
| Compound Name | (5S,8R,9S,10S,13S,14S)-2-chloro-10,13-dimethylspiro[5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,3'-dioxolane]-17-one |
|---|---|
| PubChem CID | 88686070 |
| Molecular Formula | C21H29ClO3 |
| Molecular Weight | 364.91 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S)-2-chloro-10,13-dimethylspiro[5,6,7,8,9,11,12,14,15,16-decahydro-4H-cyclopenta[a]phenanthrene-3,3'-dioxolane]-17-one |
| SMILES | C[C@]12C=C(Cl)C3(CCOO3)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H29ClO3/c1-19-8-7-16-14(15(19)5-6-18(19)23)4-3-13-11-21(9-10-24-25-21)17(22)12-20(13,16)2/h12-16H,3-11H2,1-2H3/t13-,14-,15-,16-,19-,20-,21?/m0/s1 |
| InChIKey | VJALBCBNQZKWFK-LFZTXLGFSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|