C41H47ClO3Si — CID 88687372
(1S,2R,5S,7S,9S,10S,11R,12S,13S,15S,17S)-10-chloro-2,17-dimethyl-5-tribenzylsilyloxy-8-oxahexacyclo[9.8.0.02,7.07,9.012,17.013,15]nonadecan-16-one (PubChem CID 88687372) has the molecular formula C41H47ClO3Si and a molecular weight of 651.36 g/mol. Its IUPAC name is (1S,2R,5S,7S,9S,10S,11R,12S,13S,15S,17S)-10-chloro-2,17-dimethyl-5-tribenzylsilyloxy-8-oxahexacyclo[9.8.0.02,7.07,9.012,17.013,15]nonadecan-16-one.
| Compound Name | (1S,2R,5S,7S,9S,10S,11R,12S,13S,15S,17S)-10-chloro-2,17-dimethyl-5-tribenzylsilyloxy-8-oxahexacyclo[9.8.0.02,7.07,9.012,17.013,15]nonadecan-16-one |
|---|---|
| PubChem CID | 88687372 |
| Molecular Formula | C41H47ClO3Si |
| Molecular Weight | 651.36 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | (1S,2R,5S,7S,9S,10S,11R,12S,13S,15S,17S)-10-chloro-2,17-dimethyl-5-tribenzylsilyloxy-8-oxahexacyclo[9.8.0.02,7.07,9.012,17.013,15]nonadecan-16-one |
| SMILES | C[C@]12CC[C@H]3[C@@H]([C@H](Cl)[C@H]4O[C@]45C[C@@H](O[Si](Cc4ccccc4)(Cc4ccccc4)Cc4ccccc4)CC[C@]35C)[C@@H]1[C@@H]1C[C@@H]1C2=O |
| InChI | InChI=1S/C41H47ClO3Si/c1-39-20-19-33-34(35(39)31-22-32(31)37(39)43)36(42)38-41(44-38)23-30(18-21-40(33,41)2)45-46(24-27-12-6-3-7-13-27,25-28-14-8-4-9-15-28)26-29-16-10-5-11-17-29/h3-17,30-36,38H,18-26H2,1-2H3/t30-,31+,32-,33-,34+,35-,36-,38+,39-,40+,41+/m0/s1 |
| InChIKey | JEYKARHFZQWGHV-GSCGISPASA-N |
| XLogP | 8.48 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.36 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|