C23H46N2O3 — CID 88687607
1,2,2,6,6-pentamethyl-4-(oxiran-2-ylmethoxy)piperidine;1,2,2,6,6-pentamethylpiperidin-4-ol (PubChem CID 88687607) has the molecular formula C23H46N2O3 and a molecular weight of 398.63 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-(oxiran-2-ylmethoxy)piperidine;1,2,2,6,6-pentamethylpiperidin-4-ol.
| Compound Name | 1,2,2,6,6-pentamethyl-4-(oxiran-2-ylmethoxy)piperidine;1,2,2,6,6-pentamethylpiperidin-4-ol |
|---|---|
| PubChem CID | 88687607 |
| Molecular Formula | C23H46N2O3 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.35 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-(oxiran-2-ylmethoxy)piperidine;1,2,2,6,6-pentamethylpiperidin-4-ol |
| SMILES | CN1C(C)(C)CC(O)CC1(C)C.CN1C(C)(C)CC(OCC2CO2)CC1(C)C |
| InChI | InChI=1S/C13H25NO2.C10H21NO/c1-12(2)6-10(15-8-11-9-16-11)7-13(3,4)14(12)5;1-9(2)6-8(12)7-10(3,4)11(9)5/h10-11H,6-9H2,1-5H3;8,12H,6-7H2,1-5H3 |
| InChIKey | KMEFQTIPTHEYAY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|