C34H64O4Si3 — CID 88688243
5-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]pent-2-ynal (PubChem CID 88688243) has the molecular formula C34H64O4Si3 and a molecular weight of 621.14 g/mol. Its IUPAC name is 5-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]pent-2-ynal.
| Compound Name | 5-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]pent-2-ynal |
|---|---|
| PubChem CID | 88688243 |
| Molecular Formula | C34H64O4Si3 |
| Molecular Weight | 621.14 g/mol |
| Exact Mass | 620.41 |
| IUPAC Name | 5-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]pent-2-ynal |
| SMILES | CCCCC(C)(C/C=C/[C@H]1C(CCC#CC=O)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C34H64O4Si3/c1-14-18-25-34(8,38-39(9,10)11)26-22-24-30-29(23-20-19-21-27-35)31(36-40(12,13)33(5,6)7)28-32(30)37-41(15-2,16-3)17-4/h22,24,27,30,32H,14-18,20,23,25-26,28H2,1-13H3/b24-22+/t30-,32-,34?/m0/s1 |
| InChIKey | ZMTBMBLVVVITBE-MCKXKBCRSA-N |
| XLogP | 10.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.14 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|