C19H22ClN3O5 — CID 88688420
(2R,3R,4S,5S,6R)-2-[(6-aminoacridin-3-yl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol;hydrochloride (PubChem CID 88688420) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(6-aminoacridin-3-yl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol;hydrochloride.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(6-aminoacridin-3-yl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 88688420 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(6-aminoacridin-3-yl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol;hydrochloride |
| SMILES | Cl.Nc1ccc2cc3ccc(N[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3nc2c1 |
| InChI | InChI=1S/C19H21N3O5.ClH/c20-11-3-1-9-5-10-2-4-12(7-14(10)22-13(9)6-11)21-19-18(26)17(25)16(24)15(8-23)27-19;/h1-7,15-19,21,23-26H,8,20H2;1H/t15-,16-,17+,18-,19-;/m1./s1 |
| InChIKey | RGAAFZHQGQZBLC-MQJGUIEUSA-N |
| XLogP | 0.60 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|