C12H9F18NS — CID 88688632
2-(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)ethanamine (PubChem CID 88688632) has the molecular formula C12H9F18NS and a molecular weight of 541.24 g/mol. Its IUPAC name is 2-(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)ethanamine.
| Compound Name | 2-(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 88688632 |
| Molecular Formula | C12H9F18NS |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | 2-(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)ethanamine |
| SMILES | NCCSC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F18NS/c13-4(32-2-1-31)3-5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)30/h4H,1-3,31H2 |
| InChIKey | OLLRQBQVUOQIHO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|