About S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate
S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 88689050) has the molecular formula C11H14N2O2S
and a molecular weight of 238.31 g/mol. Its IUPAC name is S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate |
| PubChem CID | 88689050 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CO/N=C/c1ccccc1SC(=O)N(C)C |
| InChI | InChI=1S/C11H14N2O2S/c1-13(2)11(14)16-10-7-5-4-6-9(10)8-12-15-3/h4-8H,1-3H3/b12-8+ |
| InChIKey | CTUXCGULBASSSS-XYOKQWHBSA-N |
| XLogP | 2.44 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate?
The IUPAC name of S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate (CID 88689050) is S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate.
What is the SMILES notation for S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate?
The canonical SMILES for S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate is CO/N=C/c1ccccc1SC(=O)N(C)C.
What is the InChIKey of S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate?
The InChIKey is CTUXCGULBASSSS-XYOKQWHBSA-N. The full InChI is InChI=1S/C11H14N2O2S/c1-13(2)11(14)16-10-7-5-4-6-9(10)8-12-15-3/h4-8H,1-3H3/b12-8+.
What are the key properties of S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate?
S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate has a molecular weight of 238.31 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[(E)-methoxyiminomethyl]phenyl] N,N-dimethylcarbamothioate is sourced from PubChem (CID 88689050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).