C12H18N4O3 — CID 88689156
1-(3,4-dihydroxy-2,6-dimethylphenyl)-3-(N'-ethylcarbamimidoyl)urea (PubChem CID 88689156) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-2,6-dimethylphenyl)-3-(N'-ethylcarbamimidoyl)urea.
| Compound Name | 1-(3,4-dihydroxy-2,6-dimethylphenyl)-3-(N'-ethylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 88689156 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-(3,4-dihydroxy-2,6-dimethylphenyl)-3-(N'-ethylcarbamimidoyl)urea |
| SMILES | CC/N=C(\N)NC(=O)Nc1c(C)cc(O)c(O)c1C |
| InChI | InChI=1S/C12H18N4O3/c1-4-14-11(13)16-12(19)15-9-6(2)5-8(17)10(18)7(9)3/h5,17-18H,4H2,1-3H3,(H4,13,14,15,16,19) |
| InChIKey | QFSGEWXTNAAEBT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|