About 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid
4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid (PubChem CID 88689210) has the molecular formula C21H36O7
and a molecular weight of 400.51 g/mol. Its IUPAC name is 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid.
Molecular Properties
| Compound Name | 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid |
| PubChem CID | 88689210 |
| Molecular Formula | C21H36O7 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid |
| SMILES | C=C(C)C(=O)OC.C=C(CCO)C(=O)O.CCC=C(CCCCCC)C(=O)O |
| InChI | InChI=1S/C11H20O2.C5H8O3.C5H8O2/c1-3-5-6-7-9-10(8-4-2)11(12)13;1-4(2-3-6)5(7)8;1-4(2)5(6)7-3/h8H,3-7,9H2,1-2H3,(H,12,13);6H,1-3H2,(H,7,8);1H2,2-3H3 |
| InChIKey | JFXVONYWTZHPCB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid?
The IUPAC name of 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid (CID 88689210) is 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid.
What is the SMILES notation for 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid?
The canonical SMILES for 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid is C=C(C)C(=O)OC.C=C(CCO)C(=O)O.CCC=C(CCCCCC)C(=O)O.
What is the InChIKey of 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid?
The InChIKey is JFXVONYWTZHPCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.C5H8O3.C5H8O2/c1-3-5-6-7-9-10(8-4-2)11(12)13;1-4(2-3-6)5(7)8;1-4(2)5(6)7-3/h8H,3-7,9H2,1-2H3,(H,12,13);6H,1-3H2,(H,7,8);1H2,2-3H3.
What are the key properties of 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid?
4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid has a molecular weight of 400.51 g/mol, XLogP of 4.12, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-methylidenebutanoic acid;methyl 2-methylprop-2-enoate;2-propylideneoctanoic acid is sourced from PubChem (CID 88689210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).