About (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate
(1-ethoxy-2-formyloxyethyl) 8-aminooctanoate (PubChem CID 88689795) has the molecular formula C13H25NO5
and a molecular weight of 275.34 g/mol. Its IUPAC name is (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate.
Molecular Properties
| Compound Name | (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate |
| PubChem CID | 88689795 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate |
| SMILES | CCOC(COC=O)OC(=O)CCCCCCCN |
| InChI | InChI=1S/C13H25NO5/c1-2-18-13(10-17-11-15)19-12(16)8-6-4-3-5-7-9-14/h11,13H,2-10,14H2,1H3 |
| InChIKey | MAKJLEPSOSJXNH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate?
The IUPAC name of (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate (CID 88689795) is (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate.
What is the SMILES notation for (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate?
The canonical SMILES for (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate is CCOC(COC=O)OC(=O)CCCCCCCN.
What is the InChIKey of (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate?
The InChIKey is MAKJLEPSOSJXNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO5/c1-2-18-13(10-17-11-15)19-12(16)8-6-4-3-5-7-9-14/h11,13H,2-10,14H2,1H3.
What are the key properties of (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate?
(1-ethoxy-2-formyloxyethyl) 8-aminooctanoate has a molecular weight of 275.34 g/mol, XLogP of 1.36, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-2-formyloxyethyl) 8-aminooctanoate is sourced from PubChem (CID 88689795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).