C13H28N4O2S2 — CID 88690044
carbamothioic S-acid;O-methyl carbamothioate;1-prop-2-enyl-4-propylpiperazine (PubChem CID 88690044) has the molecular formula C13H28N4O2S2 and a molecular weight of 336.53 g/mol. Its IUPAC name is carbamothioic S-acid;O-methyl carbamothioate;1-prop-2-enyl-4-propylpiperazine.
| Compound Name | carbamothioic S-acid;O-methyl carbamothioate;1-prop-2-enyl-4-propylpiperazine |
|---|---|
| PubChem CID | 88690044 |
| Molecular Formula | C13H28N4O2S2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | carbamothioic S-acid;O-methyl carbamothioate;1-prop-2-enyl-4-propylpiperazine |
| SMILES | C=CCN1CCN(CCC)CC1.COC(N)=S.NC(=O)S |
| InChI | InChI=1S/C10H20N2.C2H5NOS.CH3NOS/c1-3-5-11-7-9-12(6-4-2)10-8-11;1-4-2(3)5;2-1(3)4/h3H,1,4-10H2,2H3;1H3,(H2,3,5);(H3,2,3,4) |
| InChIKey | QOOAHZPLYFROKK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|